About 7-methoxy-3,3-dimethylcyclohepta-1,4,6-trien-1-amine
7-methoxy-3,3-dimethylcyclohepta-1,4,6-trien-1-amine (PubChem CID 145474083) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 7-methoxy-3,3-dimethylcyclohepta-1,4,6-trien-1-amine.
Molecular Properties
| Compound Name | 7-methoxy-3,3-dimethylcyclohepta-1,4,6-trien-1-amine |
| PubChem CID | 145474083 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 7-methoxy-3,3-dimethylcyclohepta-1,4,6-trien-1-amine |
| SMILES | COC1=CC=CC(C)(C)C=C1N |
| InChI | InChI=1S/C10H15NO/c1-10(2)6-4-5-9(12-3)8(11)7-10/h4-7H,11H2,1-3H3 |
| InChIKey | JUPKRACGYSQJLO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methoxy-3,3-dimethylcyclohepta-1,4,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-3,3-dimethylcyclohepta-1,4,6-trien-1-amine?
The IUPAC name of 7-methoxy-3,3-dimethylcyclohepta-1,4,6-trien-1-amine (CID 145474083) is 7-methoxy-3,3-dimethylcyclohepta-1,4,6-trien-1-amine.
What is the SMILES notation for 7-methoxy-3,3-dimethylcyclohepta-1,4,6-trien-1-amine?
The canonical SMILES for 7-methoxy-3,3-dimethylcyclohepta-1,4,6-trien-1-amine is COC1=CC=CC(C)(C)C=C1N.
What is the InChIKey of 7-methoxy-3,3-dimethylcyclohepta-1,4,6-trien-1-amine?
The InChIKey is JUPKRACGYSQJLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-10(2)6-4-5-9(12-3)8(11)7-10/h4-7H,11H2,1-3H3.
What are the key properties of 7-methoxy-3,3-dimethylcyclohepta-1,4,6-trien-1-amine?
7-methoxy-3,3-dimethylcyclohepta-1,4,6-trien-1-amine has a molecular weight of 165.24 g/mol, XLogP of 1.96, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3,3-dimethylcyclohepta-1,4,6-trien-1-amine is sourced from PubChem (CID 145474083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).