C12H19NO — CID 145474105
(6E,7Z)-6,7-di(ethylidene)-5-oxaspiro[3.5]nonan-8-amine (PubChem CID 145474105) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (6E,7Z)-6,7-di(ethylidene)-5-oxaspiro[3.5]nonan-8-amine.
| Compound Name | (6E,7Z)-6,7-di(ethylidene)-5-oxaspiro[3.5]nonan-8-amine |
|---|---|
| PubChem CID | 145474105 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (6E,7Z)-6,7-di(ethylidene)-5-oxaspiro[3.5]nonan-8-amine |
| SMILES | C/C=C1C(=C/C)\OC2(CCC2)CC\1N |
| InChI | InChI=1S/C12H19NO/c1-3-9-10(13)8-12(6-5-7-12)14-11(9)4-2/h3-4,10H,5-8,13H2,1-2H3/b9-3-,11-4+ |
| InChIKey | BOFRGMPSXDWSFN-NAYJDIOTSA-N |
| XLogP | 2.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |