C6H13N5 — CID 14547509
3-N,3-N-diethyl-1H-1,2,4-triazole-3,5-diamine (PubChem CID 14547509) has the molecular formula C6H13N5 and a molecular weight of 155.20 g/mol. Its IUPAC name is 3-N,3-N-diethyl-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N,3-N-diethyl-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 14547509 |
| Molecular Formula | C6H13N5 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.12 |
| IUPAC Name | 3-N,3-N-diethyl-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CCN(CC)c1n[nH]c(N)n1 |
| InChI | InChI=1S/C6H13N5/c1-3-11(4-2)6-8-5(7)9-10-6/h3-4H2,1-2H3,(H3,7,8,9,10) |
| InChIKey | OLLOMLQBEDVKOT-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |