C8H15N5 — CID 14547512
3-N-cyclohexyl-1H-1,2,4-triazole-3,5-diamine (PubChem CID 14547512) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-N-cyclohexyl-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-cyclohexyl-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 14547512 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 3-N-cyclohexyl-1H-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(NC2CCCCC2)n[nH]1 |
| InChI | InChI=1S/C8H15N5/c9-7-11-8(13-12-7)10-6-4-2-1-3-5-6/h6H,1-5H2,(H4,9,10,11,12,13) |
| InChIKey | SXFVDYFLFNDXKC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |