C14H15F2N3O — CID 145475207
1'-(2,2-difluoropropyl)-5'-iminospiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one (PubChem CID 145475207) has the molecular formula C14H15F2N3O and a molecular weight of 279.29 g/mol. Its IUPAC name is 1'-(2,2-difluoropropyl)-5'-iminospiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one.
| Compound Name | 1'-(2,2-difluoropropyl)-5'-iminospiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one |
|---|---|
| PubChem CID | 145475207 |
| Molecular Formula | C14H15F2N3O |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 1'-(2,2-difluoropropyl)-5'-iminospiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one |
| SMILES | [H]/N=C1\N(CC(C)(F)F)C(=O)NC12CCc1ccccc12 |
| InChI | InChI=1S/C14H15F2N3O/c1-13(15,16)8-19-11(17)14(18-12(19)20)7-6-9-4-2-3-5-10(9)14/h2-5,17H,6-8H2,1H3,(H,18,20)/b17-11- |
| InChIKey | LCOACOZGBKSKQF-BOPFTXTBSA-N |
| XLogP | 2.49 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|