About ethane;piperidin-4-ylmethyl 2-tert-butyl-2,4,4-trimethylpentanoate
ethane;piperidin-4-ylmethyl 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 145475559) has the molecular formula C20H41NO2
and a molecular weight of 327.55 g/mol. Its IUPAC name is ethane;piperidin-4-ylmethyl 2-tert-butyl-2,4,4-trimethylpentanoate.
Molecular Properties
| Compound Name | ethane;piperidin-4-ylmethyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| PubChem CID | 145475559 |
| Molecular Formula | C20H41NO2 |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 327.31 |
| IUPAC Name | ethane;piperidin-4-ylmethyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC.CC(C)(C)CC(C)(C(=O)OCC1CCNCC1)C(C)(C)C |
| InChI | InChI=1S/C18H35NO2.C2H6/c1-16(2,3)13-18(7,17(4,5)6)15(20)21-12-14-8-10-19-11-9-14;1-2/h14,19H,8-13H2,1-7H3;1-2H3 |
| InChIKey | NFFYTZHDFSFRFB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;piperidin-4-ylmethyl 2-tert-butyl-2,4,4-trimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;piperidin-4-ylmethyl 2-tert-butyl-2,4,4-trimethylpentanoate?
The IUPAC name of ethane;piperidin-4-ylmethyl 2-tert-butyl-2,4,4-trimethylpentanoate (CID 145475559) is ethane;piperidin-4-ylmethyl 2-tert-butyl-2,4,4-trimethylpentanoate.
What is the SMILES notation for ethane;piperidin-4-ylmethyl 2-tert-butyl-2,4,4-trimethylpentanoate?
The canonical SMILES for ethane;piperidin-4-ylmethyl 2-tert-butyl-2,4,4-trimethylpentanoate is CC.CC(C)(C)CC(C)(C(=O)OCC1CCNCC1)C(C)(C)C.
What is the InChIKey of ethane;piperidin-4-ylmethyl 2-tert-butyl-2,4,4-trimethylpentanoate?
The InChIKey is NFFYTZHDFSFRFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35NO2.C2H6/c1-16(2,3)13-18(7,17(4,5)6)15(20)21-12-14-8-10-19-11-9-14;1-2/h14,19H,8-13H2,1-7H3;1-2H3.
What are the key properties of ethane;piperidin-4-ylmethyl 2-tert-butyl-2,4,4-trimethylpentanoate?
ethane;piperidin-4-ylmethyl 2-tert-butyl-2,4,4-trimethylpentanoate has a molecular weight of 327.55 g/mol, XLogP of 5.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;piperidin-4-ylmethyl 2-tert-butyl-2,4,4-trimethylpentanoate is sourced from PubChem (CID 145475559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).