C25H35N5O — CID 145475582
2-[4-[2-(4-butyl-N-methylanilino)acetyl]piperazin-1-yl]pyridine-3-carbonitrile;ethane (PubChem CID 145475582) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-[4-[2-(4-butyl-N-methylanilino)acetyl]piperazin-1-yl]pyridine-3-carbonitrile;ethane.
| Compound Name | 2-[4-[2-(4-butyl-N-methylanilino)acetyl]piperazin-1-yl]pyridine-3-carbonitrile;ethane |
|---|---|
| PubChem CID | 145475582 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 2-[4-[2-(4-butyl-N-methylanilino)acetyl]piperazin-1-yl]pyridine-3-carbonitrile;ethane |
| SMILES | CC.CCCCc1ccc(N(C)CC(=O)N2CCN(c3ncccc3C#N)CC2)cc1 |
| InChI | InChI=1S/C23H29N5O.C2H6/c1-3-4-6-19-8-10-21(11-9-19)26(2)18-22(29)27-13-15-28(16-14-27)23-20(17-24)7-5-12-25-23;1-2/h5,7-12H,3-4,6,13-16,18H2,1-2H3;1-2H3 |
| InChIKey | ACNNFOQAVOTNJA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|