About 4-[(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]phenol;rhenium
4-[(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]phenol;rhenium (PubChem CID 145475750) has the molecular formula C15H15ORe-
and a molecular weight of 397.49 g/mol. Its IUPAC name is 4-[(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]phenol;rhenium.
Molecular Properties
| Compound Name | 4-[(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]phenol;rhenium |
| PubChem CID | 145475750 |
| Molecular Formula | C15H15ORe- |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 4-[(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]phenol;rhenium |
| SMILES | CC1C=CC=C([CH-]c2ccc(O)cc2)C=C1.[Re] |
| InChI | InChI=1S/C15H15O.Re/c1-12-3-2-4-13(6-5-12)11-14-7-9-15(16)10-8-14;/h2-12,16H,1H3;/q-1; |
| InChIKey | ZYWMCPZSAMZJEJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]phenol;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]phenol;rhenium?
The IUPAC name of 4-[(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]phenol;rhenium (CID 145475750) is 4-[(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]phenol;rhenium.
What is the SMILES notation for 4-[(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]phenol;rhenium?
The canonical SMILES for 4-[(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]phenol;rhenium is CC1C=CC=C([CH-]c2ccc(O)cc2)C=C1.[Re].
What is the InChIKey of 4-[(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]phenol;rhenium?
The InChIKey is ZYWMCPZSAMZJEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15O.Re/c1-12-3-2-4-13(6-5-12)11-14-7-9-15(16)10-8-14;/h2-12,16H,1H3;/q-1;.
What are the key properties of 4-[(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]phenol;rhenium?
4-[(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]phenol;rhenium has a molecular weight of 397.49 g/mol, XLogP of 3.63, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]phenol;rhenium is sourced from PubChem (CID 145475750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).