About CID 145476302
CID 145476302 (PubChem CID 145476302) has the molecular formula C18H20BN2O2S2U-
and a molecular weight of 609.35 g/mol.
Molecular Properties
| Compound Name | CID 145476302 |
| PubChem CID | 145476302 |
| Molecular Formula | C18H20BN2O2S2U- |
| Molecular Weight | 609.35 g/mol |
| Exact Mass | 609.16 |
| IUPAC Name | — |
| SMILES | [B]C(=O)C(C)CC(Cc1c[c-]cc(S)c1)NC(=O)c1csc(CC)n1.[U] |
| InChI | InChI=1S/C18H20BN2O2S2.U/c1-3-16-21-15(10-25-16)18(23)20-13(7-11(2)17(19)22)8-12-5-4-6-14(24)9-12;/h5-6,9-11,13,24H,3,7-8H2,1-2H3,(H,20,23);/q-1; |
| InChIKey | MNRZIKJXWZBVJW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 609.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 145476302 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145476302?
The IUPAC name of CID 145476302 (CID 145476302) is not available.
What is the SMILES notation for CID 145476302?
The canonical SMILES for CID 145476302 is [B]C(=O)C(C)CC(Cc1c[c-]cc(S)c1)NC(=O)c1csc(CC)n1.[U].
What is the InChIKey of CID 145476302?
The InChIKey is MNRZIKJXWZBVJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20BN2O2S2.U/c1-3-16-21-15(10-25-16)18(23)20-13(7-11(2)17(19)22)8-12-5-4-6-14(24)9-12;/h5-6,9-11,13,24H,3,7-8H2,1-2H3,(H,20,23);/q-1;.
What are the key properties of CID 145476302?
CID 145476302 has a molecular weight of 609.35 g/mol, XLogP of 2.86, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145476302 is sourced from PubChem (CID 145476302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).