C21H21Cl2FeN2O4S- — CID 145476753
tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-(1-methyl-3H-indol-3-id-6-yl)amino]acetate;iron (PubChem CID 145476753) has the molecular formula C21H21Cl2FeN2O4S- and a molecular weight of 524.23 g/mol. Its IUPAC name is tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-(1-methyl-3H-indol-3-id-6-yl)amino]acetate;iron.
| Compound Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-(1-methyl-3H-indol-3-id-6-yl)amino]acetate;iron |
|---|---|
| PubChem CID | 145476753 |
| Molecular Formula | C21H21Cl2FeN2O4S- |
| Molecular Weight | 524.23 g/mol |
| Exact Mass | 523.00 |
| IUPAC Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-(1-methyl-3H-indol-3-id-6-yl)amino]acetate;iron |
| SMILES | Cn1c[c-]c2ccc(N(CC(=O)OC(C)(C)C)S(=O)(=O)c3cc(Cl)cc(Cl)c3)cc21.[Fe] |
| InChI | InChI=1S/C21H21Cl2N2O4S.Fe/c1-21(2,3)29-20(26)13-25(17-6-5-14-7-8-24(4)19(14)12-17)30(27,28)18-10-15(22)9-16(23)11-18;/h5-6,8-12H,13H2,1-4H3;/q-1; |
| InChIKey | JRVMZGIFQPDNAQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.23 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|