C28H32N2O5 — CID 145476861
(17-acetyl-13-methyl-3-oxo-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl) N-(3-carbamoylphenyl)carbamate (PubChem CID 145476861) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is (17-acetyl-13-methyl-3-oxo-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl) N-(3-carbamoylphenyl)carbamate.
| Compound Name | (17-acetyl-13-methyl-3-oxo-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl) N-(3-carbamoylphenyl)carbamate |
|---|---|
| PubChem CID | 145476861 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (17-acetyl-13-methyl-3-oxo-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl) N-(3-carbamoylphenyl)carbamate |
| SMILES | CC(=O)C1CCC2C3C=CC4=CC(=O)CCC4C3C(OC(=O)Nc3cccc(C(N)=O)c3)CC12C |
| InChI | InChI=1S/C28H32N2O5/c1-15(31)22-10-11-23-21-8-6-16-13-19(32)7-9-20(16)25(21)24(14-28(22,23)2)35-27(34)30-18-5-3-4-17(12-18)26(29)33/h3-6,8,12-13,20-25H,7,9-11,14H2,1-2H3,(H2,29,33)(H,30,34) |
| InChIKey | WDRNTHPNODFOLI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |