C19H27ClN7O2+ — CID 145477014
[3-[8-chloro-10-[3-(dimethylamino)propyl]-2,4-dioxobenzo[g]pteridin-3-yl]propyl-methylamino]azanium (PubChem CID 145477014) has the molecular formula C19H27ClN7O2+ and a molecular weight of 420.93 g/mol. Its IUPAC name is [3-[8-chloro-10-[3-(dimethylamino)propyl]-2,4-dioxobenzo[g]pteridin-3-yl]propyl-methylamino]azanium.
| Compound Name | [3-[8-chloro-10-[3-(dimethylamino)propyl]-2,4-dioxobenzo[g]pteridin-3-yl]propyl-methylamino]azanium |
|---|---|
| PubChem CID | 145477014 |
| Molecular Formula | C19H27ClN7O2+ |
| Molecular Weight | 420.93 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | [3-[8-chloro-10-[3-(dimethylamino)propyl]-2,4-dioxobenzo[g]pteridin-3-yl]propyl-methylamino]azanium |
| SMILES | CN(C)CCCn1c2nc(=O)n(CCCN(C)[NH3+])c(=O)c-2nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H26ClN7O2/c1-24(2)8-4-10-26-15-12-13(20)6-7-14(15)22-16-17(26)23-19(29)27(18(16)28)11-5-9-25(3)21/h6-7,12H,4-5,8-11,21H2,1-3H3/p+1 |
| InChIKey | MBFSMCACVYPXAP-UHFFFAOYSA-O |
| XLogP | 0.14 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.93 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|