C41H30N4 — CID 145477230
(Z)-2-[3-methyl-1-[3-(2-phenanthren-2-yl-6-pyridin-2-yl-4-pyridinyl)phenyl]indol-2-yl]ethenamine (PubChem CID 145477230) has the molecular formula C41H30N4 and a molecular weight of 578.72 g/mol. Its IUPAC name is (Z)-2-[3-methyl-1-[3-(2-phenanthren-2-yl-6-pyridin-2-yl-4-pyridinyl)phenyl]indol-2-yl]ethenamine.
| Compound Name | (Z)-2-[3-methyl-1-[3-(2-phenanthren-2-yl-6-pyridin-2-yl-4-pyridinyl)phenyl]indol-2-yl]ethenamine |
|---|---|
| PubChem CID | 145477230 |
| Molecular Formula | C41H30N4 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | (Z)-2-[3-methyl-1-[3-(2-phenanthren-2-yl-6-pyridin-2-yl-4-pyridinyl)phenyl]indol-2-yl]ethenamine |
| SMILES | Cc1c(/C=C\N)n(-c2cccc(-c3cc(-c4ccc5c(ccc6ccccc65)c4)nc(-c4ccccn4)c3)c2)c2ccccc12 |
| InChI | InChI=1S/C41H30N4/c1-27-34-12-4-5-15-41(34)45(40(27)20-21-42)33-11-8-10-29(24-33)32-25-38(44-39(26-32)37-14-6-7-22-43-37)31-18-19-36-30(23-31)17-16-28-9-2-3-13-35(28)36/h2-26H,42H2,1H3/b21-20- |
| InChIKey | MEFITWZMOZOPRR-MRCUWXFGSA-N |
| XLogP | 9.97 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|