About 2-methylpent-1-ene;tetramethylazanium
2-methylpent-1-ene;tetramethylazanium (PubChem CID 145477232) has the molecular formula C10H24N+
and a molecular weight of 158.31 g/mol. Its IUPAC name is 2-methylpent-1-ene;tetramethylazanium.
Molecular Properties
| Compound Name | 2-methylpent-1-ene;tetramethylazanium |
| PubChem CID | 145477232 |
| Molecular Formula | C10H24N+ |
| Molecular Weight | 158.31 g/mol |
| Exact Mass | 158.19 |
| IUPAC Name | 2-methylpent-1-ene;tetramethylazanium |
| SMILES | C=C(C)CCC.C[N+](C)(C)C |
| InChI | InChI=1S/C6H12.C4H12N/c1-4-5-6(2)3;1-5(2,3)4/h2,4-5H2,1,3H3;1-4H3/q;+1 |
| InChIKey | BKQJRAPNHMJVEG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpent-1-ene;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpent-1-ene;tetramethylazanium?
The IUPAC name of 2-methylpent-1-ene;tetramethylazanium (CID 145477232) is 2-methylpent-1-ene;tetramethylazanium.
What is the SMILES notation for 2-methylpent-1-ene;tetramethylazanium?
The canonical SMILES for 2-methylpent-1-ene;tetramethylazanium is C=C(C)CCC.C[N+](C)(C)C.
What is the InChIKey of 2-methylpent-1-ene;tetramethylazanium?
The InChIKey is BKQJRAPNHMJVEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.C4H12N/c1-4-5-6(2)3;1-5(2,3)4/h2,4-5H2,1,3H3;1-4H3/q;+1.
What are the key properties of 2-methylpent-1-ene;tetramethylazanium?
2-methylpent-1-ene;tetramethylazanium has a molecular weight of 158.31 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpent-1-ene;tetramethylazanium is sourced from PubChem (CID 145477232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).