C26H46N8O2 — CID 145477269
(E)-2-amino-3-(butoxymethylamino)-N-methylidene-3-[[4-[[4-(2-oxoethyl)piperazin-1-yl]methyl]phenyl]methylamino]prop-2-enimidamide;N,N-dimethylmethanamine (PubChem CID 145477269) has the molecular formula C26H46N8O2 and a molecular weight of 502.71 g/mol. Its IUPAC name is (E)-2-amino-3-(butoxymethylamino)-N-methylidene-3-[[4-[[4-(2-oxoethyl)piperazin-1-yl]methyl]phenyl]methylamino]prop-2-enimidamide;N,N-dimethylmethanamine.
| Compound Name | (E)-2-amino-3-(butoxymethylamino)-N-methylidene-3-[[4-[[4-(2-oxoethyl)piperazin-1-yl]methyl]phenyl]methylamino]prop-2-enimidamide;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 145477269 |
| Molecular Formula | C26H46N8O2 |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | (E)-2-amino-3-(butoxymethylamino)-N-methylidene-3-[[4-[[4-(2-oxoethyl)piperazin-1-yl]methyl]phenyl]methylamino]prop-2-enimidamide;N,N-dimethylmethanamine |
| SMILES | CN(C)C.[H]/N=C(N=C)/C(N)=C(\NCOCCCC)NCc1ccc(CN2CCN(CC=O)CC2)cc1 |
| InChI | InChI=1S/C23H37N7O2.C3H9N/c1-3-4-15-32-18-28-23(21(24)22(25)26-2)27-16-19-5-7-20(8-6-19)17-30-11-9-29(10-12-30)13-14-31;1-4(2)3/h5-8,14,25,27-28H,2-4,9-13,15-18,24H2,1H3;1-3H3/b23-21+,25-22-; |
| InChIKey | QYKGYBSZGJKIGA-XSWMZYOXSA-N |
| XLogP | 1.44 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|