C21H31F3N6O2 — CID 145477286
(E)-2-amino-N-methylidene-3-[[4-(morpholin-4-ylmethyl)phenyl]methylamino]-3-(4,4,4-trifluorobutoxymethylamino)prop-2-enimidamide (PubChem CID 145477286) has the molecular formula C21H31F3N6O2 and a molecular weight of 456.51 g/mol. Its IUPAC name is (E)-2-amino-N-methylidene-3-[[4-(morpholin-4-ylmethyl)phenyl]methylamino]-3-(4,4,4-trifluorobutoxymethylamino)prop-2-enimidamide.
| Compound Name | (E)-2-amino-N-methylidene-3-[[4-(morpholin-4-ylmethyl)phenyl]methylamino]-3-(4,4,4-trifluorobutoxymethylamino)prop-2-enimidamide |
|---|---|
| PubChem CID | 145477286 |
| Molecular Formula | C21H31F3N6O2 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | (E)-2-amino-N-methylidene-3-[[4-(morpholin-4-ylmethyl)phenyl]methylamino]-3-(4,4,4-trifluorobutoxymethylamino)prop-2-enimidamide |
| SMILES | [H]/N=C(N=C)/C(N)=C(\NCOCCCC(F)(F)F)NCc1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C21H31F3N6O2/c1-27-19(26)18(25)20(29-15-32-10-2-7-21(22,23)24)28-13-16-3-5-17(6-4-16)14-30-8-11-31-12-9-30/h3-6,26,28-29H,1-2,7-15,25H2/b20-18+,26-19- |
| InChIKey | KFFSFZUPYOPDJK-YREFIWLBSA-N |
| XLogP | 2.32 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|