About 2,1,3-benzoxadiazole-4-thiol;3-chloro-4-morpholin-4-ylaniline
2,1,3-benzoxadiazole-4-thiol;3-chloro-4-morpholin-4-ylaniline (PubChem CID 145477512) has the molecular formula C16H17ClN4O2S
and a molecular weight of 364.86 g/mol. Its IUPAC name is 2,1,3-benzoxadiazole-4-thiol;3-chloro-4-morpholin-4-ylaniline.
Molecular Properties
| Compound Name | 2,1,3-benzoxadiazole-4-thiol;3-chloro-4-morpholin-4-ylaniline |
| PubChem CID | 145477512 |
| Molecular Formula | C16H17ClN4O2S |
| Molecular Weight | 364.86 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 2,1,3-benzoxadiazole-4-thiol;3-chloro-4-morpholin-4-ylaniline |
| SMILES | Nc1ccc(N2CCOCC2)c(Cl)c1.Sc1cccc2nonc12 |
| InChI | InChI=1S/C10H13ClN2O.C6H4N2OS/c11-9-7-8(12)1-2-10(9)13-3-5-14-6-4-13;10-5-3-1-2-4-6(5)8-9-7-4/h1-2,7H,3-6,12H2;1-3,10H |
| InChIKey | QPFMDIUFVGQISU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.86 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,1,3-benzoxadiazole-4-thiol;3-chloro-4-morpholin-4-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,1,3-benzoxadiazole-4-thiol;3-chloro-4-morpholin-4-ylaniline?
The IUPAC name of 2,1,3-benzoxadiazole-4-thiol;3-chloro-4-morpholin-4-ylaniline (CID 145477512) is 2,1,3-benzoxadiazole-4-thiol;3-chloro-4-morpholin-4-ylaniline.
What is the SMILES notation for 2,1,3-benzoxadiazole-4-thiol;3-chloro-4-morpholin-4-ylaniline?
The canonical SMILES for 2,1,3-benzoxadiazole-4-thiol;3-chloro-4-morpholin-4-ylaniline is Nc1ccc(N2CCOCC2)c(Cl)c1.Sc1cccc2nonc12.
What is the InChIKey of 2,1,3-benzoxadiazole-4-thiol;3-chloro-4-morpholin-4-ylaniline?
The InChIKey is QPFMDIUFVGQISU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN2O.C6H4N2OS/c11-9-7-8(12)1-2-10(9)13-3-5-14-6-4-13;10-5-3-1-2-4-6(5)8-9-7-4/h1-2,7H,3-6,12H2;1-3,10H.
What are the key properties of 2,1,3-benzoxadiazole-4-thiol;3-chloro-4-morpholin-4-ylaniline?
2,1,3-benzoxadiazole-4-thiol;3-chloro-4-morpholin-4-ylaniline has a molecular weight of 364.86 g/mol, XLogP of 3.27, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,1,3-benzoxadiazole-4-thiol;3-chloro-4-morpholin-4-ylaniline is sourced from PubChem (CID 145477512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).