C28H26N6O2S2 — CID 145477587
N-[2-[methyl-[1-[(7-quinolin-8-ylsulfanyl-2,1,3-benzoxadiazol-4-yl)sulfanyl]piperidin-4-yl]amino]phenyl]formamide (PubChem CID 145477587) has the molecular formula C28H26N6O2S2 and a molecular weight of 542.69 g/mol. Its IUPAC name is N-[2-[methyl-[1-[(7-quinolin-8-ylsulfanyl-2,1,3-benzoxadiazol-4-yl)sulfanyl]piperidin-4-yl]amino]phenyl]formamide.
| Compound Name | N-[2-[methyl-[1-[(7-quinolin-8-ylsulfanyl-2,1,3-benzoxadiazol-4-yl)sulfanyl]piperidin-4-yl]amino]phenyl]formamide |
|---|---|
| PubChem CID | 145477587 |
| Molecular Formula | C28H26N6O2S2 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | N-[2-[methyl-[1-[(7-quinolin-8-ylsulfanyl-2,1,3-benzoxadiazol-4-yl)sulfanyl]piperidin-4-yl]amino]phenyl]formamide |
| SMILES | CN(c1ccccc1NC=O)C1CCN(Sc2ccc(Sc3cccc4cccnc34)c3nonc23)CC1 |
| InChI | InChI=1S/C28H26N6O2S2/c1-33(22-9-3-2-8-21(22)30-18-35)20-13-16-34(17-14-20)38-25-12-11-24(27-28(25)32-36-31-27)37-23-10-4-6-19-7-5-15-29-26(19)23/h2-12,15,18,20H,13-14,16-17H2,1H3,(H,30,35) |
| InChIKey | LLVBNGPZWXCJGK-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|