About (Z)-4-imino-N,2-dimethylbut-2-enamide
(Z)-4-imino-N,2-dimethylbut-2-enamide (PubChem CID 145478342) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is (Z)-4-imino-N,2-dimethylbut-2-enamide.
Molecular Properties
| Compound Name | (Z)-4-imino-N,2-dimethylbut-2-enamide |
| PubChem CID | 145478342 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | (Z)-4-imino-N,2-dimethylbut-2-enamide |
| SMILES | [H]/N=C/C=C(/C)C(=O)NC |
| InChI | InChI=1S/C6H10N2O/c1-5(3-4-7)6(9)8-2/h3-4,7H,1-2H3,(H,8,9)/b5-3-,7-4+ |
| InChIKey | QFARJMSTAYMLNX-XKSOLRDRSA-N |
| XLogP | 0.33 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-imino-N,2-dimethylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-imino-N,2-dimethylbut-2-enamide?
The IUPAC name of (Z)-4-imino-N,2-dimethylbut-2-enamide (CID 145478342) is (Z)-4-imino-N,2-dimethylbut-2-enamide.
What is the SMILES notation for (Z)-4-imino-N,2-dimethylbut-2-enamide?
The canonical SMILES for (Z)-4-imino-N,2-dimethylbut-2-enamide is [H]/N=C/C=C(/C)C(=O)NC.
What is the InChIKey of (Z)-4-imino-N,2-dimethylbut-2-enamide?
The InChIKey is QFARJMSTAYMLNX-XKSOLRDRSA-N. The full InChI is InChI=1S/C6H10N2O/c1-5(3-4-7)6(9)8-2/h3-4,7H,1-2H3,(H,8,9)/b5-3-,7-4+.
What are the key properties of (Z)-4-imino-N,2-dimethylbut-2-enamide?
(Z)-4-imino-N,2-dimethylbut-2-enamide has a molecular weight of 126.16 g/mol, XLogP of 0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-imino-N,2-dimethylbut-2-enamide is sourced from PubChem (CID 145478342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).