C31H55N3O4 — CID 145478501
1-(4-amino-3-methoxyphenyl)-7-[ethyl-[ethyl(methyl)amino]amino]heptan-2-one;3-(cyclobutylmethoxy)but-3-en-2-one;propane (PubChem CID 145478501) has the molecular formula C31H55N3O4 and a molecular weight of 533.80 g/mol. Its IUPAC name is 1-(4-amino-3-methoxyphenyl)-7-[ethyl-[ethyl(methyl)amino]amino]heptan-2-one;3-(cyclobutylmethoxy)but-3-en-2-one;propane.
| Compound Name | 1-(4-amino-3-methoxyphenyl)-7-[ethyl-[ethyl(methyl)amino]amino]heptan-2-one;3-(cyclobutylmethoxy)but-3-en-2-one;propane |
|---|---|
| PubChem CID | 145478501 |
| Molecular Formula | C31H55N3O4 |
| Molecular Weight | 533.80 g/mol |
| Exact Mass | 533.42 |
| IUPAC Name | 1-(4-amino-3-methoxyphenyl)-7-[ethyl-[ethyl(methyl)amino]amino]heptan-2-one;3-(cyclobutylmethoxy)but-3-en-2-one;propane |
| SMILES | C=C(OCC1CCC1)C(C)=O.CCC.CCN(C)N(CC)CCCCCC(=O)Cc1ccc(N)c(OC)c1 |
| InChI | InChI=1S/C19H33N3O2.C9H14O2.C3H8/c1-5-21(3)22(6-2)13-9-7-8-10-17(23)14-16-11-12-18(20)19(15-16)24-4;1-7(10)8(2)11-6-9-4-3-5-9;1-3-2/h11-12,15H,5-10,13-14,20H2,1-4H3;9H,2-6H2,1H3;3H2,1-2H3 |
| InChIKey | ROXRLRCDJDSWHD-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.80 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|