C27H35F3N4O2 — CID 145478515
(Z)-3-[2-aminoethyl(ethyl)amino]-2-[(5,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-N-(3-fluoro-5-methylphenyl)-4-iminobut-2-enamide;ethane (PubChem CID 145478515) has the molecular formula C27H35F3N4O2 and a molecular weight of 504.60 g/mol. Its IUPAC name is (Z)-3-[2-aminoethyl(ethyl)amino]-2-[(5,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-N-(3-fluoro-5-methylphenyl)-4-iminobut-2-enamide;ethane.
| Compound Name | (Z)-3-[2-aminoethyl(ethyl)amino]-2-[(5,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-N-(3-fluoro-5-methylphenyl)-4-iminobut-2-enamide;ethane |
|---|---|
| PubChem CID | 145478515 |
| Molecular Formula | C27H35F3N4O2 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | (Z)-3-[2-aminoethyl(ethyl)amino]-2-[(5,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-N-(3-fluoro-5-methylphenyl)-4-iminobut-2-enamide;ethane |
| SMILES | CC.[H]/N=C/C(=C(/OC1CCc2c(F)ccc(F)c2C1)C(=O)Nc1cc(C)cc(F)c1)N(CC)CCN |
| InChI | InChI=1S/C25H29F3N4O2.C2H6/c1-3-32(9-8-29)23(14-30)24(25(33)31-17-11-15(2)10-16(26)12-17)34-18-4-5-19-20(13-18)22(28)7-6-21(19)27;1-2/h6-7,10-12,14,18,30H,3-5,8-9,13,29H2,1-2H3,(H,31,33);1-2H3/b24-23-,30-14+; |
| InChIKey | BUUFDKWBPDKFLO-MMJWGLPTSA-N |
| XLogP | 5.09 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|