About N-ethyl-5-methyl-2,3-dihydrothiophene-2-carboxamide
N-ethyl-5-methyl-2,3-dihydrothiophene-2-carboxamide (PubChem CID 145478837) has the molecular formula C8H13NOS
and a molecular weight of 171.26 g/mol. Its IUPAC name is N-ethyl-5-methyl-2,3-dihydrothiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-5-methyl-2,3-dihydrothiophene-2-carboxamide |
| PubChem CID | 145478837 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | N-ethyl-5-methyl-2,3-dihydrothiophene-2-carboxamide |
| SMILES | CCNC(=O)C1CC=C(C)S1 |
| InChI | InChI=1S/C8H13NOS/c1-3-9-8(10)7-5-4-6(2)11-7/h4,7H,3,5H2,1-2H3,(H,9,10) |
| InChIKey | SOUNOUIQLHXLNJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-5-methyl-2,3-dihydrothiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5-methyl-2,3-dihydrothiophene-2-carboxamide?
The IUPAC name of N-ethyl-5-methyl-2,3-dihydrothiophene-2-carboxamide (CID 145478837) is N-ethyl-5-methyl-2,3-dihydrothiophene-2-carboxamide.
What is the SMILES notation for N-ethyl-5-methyl-2,3-dihydrothiophene-2-carboxamide?
The canonical SMILES for N-ethyl-5-methyl-2,3-dihydrothiophene-2-carboxamide is CCNC(=O)C1CC=C(C)S1.
What is the InChIKey of N-ethyl-5-methyl-2,3-dihydrothiophene-2-carboxamide?
The InChIKey is SOUNOUIQLHXLNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NOS/c1-3-9-8(10)7-5-4-6(2)11-7/h4,7H,3,5H2,1-2H3,(H,9,10).
What are the key properties of N-ethyl-5-methyl-2,3-dihydrothiophene-2-carboxamide?
N-ethyl-5-methyl-2,3-dihydrothiophene-2-carboxamide has a molecular weight of 171.26 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5-methyl-2,3-dihydrothiophene-2-carboxamide is sourced from PubChem (CID 145478837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).