C32H36F3N3O3 — CID 145479769
(2Z)-2-amino-2-[2-(2,4-difluorophenyl)imino-3-[(3-fluorophenyl)methyl]cycloheptylidene]acetaldehyde;ethyl (2S,3R)-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 145479769) has the molecular formula C32H36F3N3O3 and a molecular weight of 567.65 g/mol. Its IUPAC name is (2Z)-2-amino-2-[2-(2,4-difluorophenyl)imino-3-[(3-fluorophenyl)methyl]cycloheptylidene]acetaldehyde;ethyl (2S,3R)-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (2Z)-2-amino-2-[2-(2,4-difluorophenyl)imino-3-[(3-fluorophenyl)methyl]cycloheptylidene]acetaldehyde;ethyl (2S,3R)-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 145479769 |
| Molecular Formula | C32H36F3N3O3 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | (2Z)-2-amino-2-[2-(2,4-difluorophenyl)imino-3-[(3-fluorophenyl)methyl]cycloheptylidene]acetaldehyde;ethyl (2S,3R)-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C2C=CC(C2)[C@H]1N.N/C(C=O)=C1/CCCCC(Cc2cccc(F)c2)/C1=N\c1ccc(F)cc1F |
| InChI | InChI=1S/C22H21F3N2O.C10H15NO2/c23-16-6-3-4-14(11-16)10-15-5-1-2-7-18(20(26)13-28)22(15)27-21-9-8-17(24)12-19(21)25;1-2-13-10(12)8-6-3-4-7(5-6)9(8)11/h3-4,6,8-9,11-13,15H,1-2,5,7,10,26H2;3-4,6-9H,2,5,11H2,1H3/b20-18-,27-22+;/t;6?,7?,8-,9+/m.0/s1 |
| InChIKey | SRYTXCBJEGLSSJ-CICZTEOHSA-N |
| XLogP | 5.72 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|