C19H20N4O2S — CID 145479959
4-methyl-5-[4-(methylamino)-1-pent-4-ynylimidazo[4,5-c]pyridin-2-yl]sulfanylbenzene-1,2-diol (PubChem CID 145479959) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-methyl-5-[4-(methylamino)-1-pent-4-ynylimidazo[4,5-c]pyridin-2-yl]sulfanylbenzene-1,2-diol.
| Compound Name | 4-methyl-5-[4-(methylamino)-1-pent-4-ynylimidazo[4,5-c]pyridin-2-yl]sulfanylbenzene-1,2-diol |
|---|---|
| PubChem CID | 145479959 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4-methyl-5-[4-(methylamino)-1-pent-4-ynylimidazo[4,5-c]pyridin-2-yl]sulfanylbenzene-1,2-diol |
| SMILES | C#CCCCn1c(Sc2cc(O)c(O)cc2C)nc2c(NC)nccc21 |
| InChI | InChI=1S/C19H20N4O2S/c1-4-5-6-9-23-13-7-8-21-18(20-3)17(13)22-19(23)26-16-11-15(25)14(24)10-12(16)2/h1,7-8,10-11,24-25H,5-6,9H2,2-3H3,(H,20,21) |
| InChIKey | DGGSARROMYAXER-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|