About CID 145480016
CID 145480016 (PubChem CID 145480016) has the molecular formula C4H3BN2S
and a molecular weight of 121.96 g/mol.
Molecular Properties
| Compound Name | CID 145480016 |
| PubChem CID | 145480016 |
| Molecular Formula | C4H3BN2S |
| Molecular Weight | 121.96 g/mol |
| Exact Mass | 122.01 |
| IUPAC Name | — |
| SMILES | [B]c1nccc(=S)[nH]1 |
| InChI | InChI=1S/C4H3BN2S/c5-4-6-2-1-3(8)7-4/h1-2H,(H,6,7,8) |
| InChIKey | OMNGCRBONSTPIN-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.96 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 145480016 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145480016?
The IUPAC name of CID 145480016 (CID 145480016) is not available.
What is the SMILES notation for CID 145480016?
The canonical SMILES for CID 145480016 is [B]c1nccc(=S)[nH]1.
What is the InChIKey of CID 145480016?
The InChIKey is OMNGCRBONSTPIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3BN2S/c5-4-6-2-1-3(8)7-4/h1-2H,(H,6,7,8).
What are the key properties of CID 145480016?
CID 145480016 has a molecular weight of 121.96 g/mol, XLogP of -0.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145480016 is sourced from PubChem (CID 145480016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).