C18H17FN4O2 — CID 145480210
4-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-2-(3-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carboximidoyl fluoride (PubChem CID 145480210) has the molecular formula C18H17FN4O2 and a molecular weight of 340.36 g/mol. Its IUPAC name is 4-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-2-(3-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carboximidoyl fluoride.
| Compound Name | 4-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-2-(3-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carboximidoyl fluoride |
|---|---|
| PubChem CID | 145480210 |
| Molecular Formula | C18H17FN4O2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 4-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-2-(3-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carboximidoyl fluoride |
| SMILES | [H]/N=C(\F)c1c(N/C(C=C)=C/C=C)nc(-c2cccc(OC)c2)[nH]c1=O |
| InChI | InChI=1S/C18H17FN4O2/c1-4-7-12(5-2)21-17-14(15(19)20)18(24)23-16(22-17)11-8-6-9-13(10-11)25-3/h4-10,20H,1-2H2,3H3,(H2,21,22,23,24)/b12-7+,20-15- |
| InChIKey | OJRWCYXVPFVTOT-JSNWSPKXSA-N |
| XLogP | 3.41 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|