C12H14FN — CID 145480550
(Z,4Z)-N-(1-fluoroethenyl)-6-methyl-2,3-dimethylidenehepta-4,6-dien-1-imine (PubChem CID 145480550) has the molecular formula C12H14FN and a molecular weight of 191.25 g/mol. Its IUPAC name is (Z,4Z)-N-(1-fluoroethenyl)-6-methyl-2,3-dimethylidenehepta-4,6-dien-1-imine.
| Compound Name | (Z,4Z)-N-(1-fluoroethenyl)-6-methyl-2,3-dimethylidenehepta-4,6-dien-1-imine |
|---|---|
| PubChem CID | 145480550 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (Z,4Z)-N-(1-fluoroethenyl)-6-methyl-2,3-dimethylidenehepta-4,6-dien-1-imine |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C=N\C(=C)F |
| InChI | InChI=1S/C12H14FN/c1-9(2)6-7-10(3)11(4)8-14-12(5)13/h6-8H,1,3-5H2,2H3/b7-6-,14-8- |
| InChIKey | BDXUKMZSFSNCEN-PMAMELDRSA-N |
| XLogP | 3.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|