C20H17Cl2N3OS2 — CID 145481005
1-[8-[(3,5-dichloro-4-pyridinyl)methoxy]-2-methylquinolin-4-yl]sulfanyl-1-ethenylsulfanyl-N-methylmethanimine (PubChem CID 145481005) has the molecular formula C20H17Cl2N3OS2 and a molecular weight of 450.42 g/mol. Its IUPAC name is 1-[8-[(3,5-dichloro-4-pyridinyl)methoxy]-2-methylquinolin-4-yl]sulfanyl-1-ethenylsulfanyl-N-methylmethanimine.
| Compound Name | 1-[8-[(3,5-dichloro-4-pyridinyl)methoxy]-2-methylquinolin-4-yl]sulfanyl-1-ethenylsulfanyl-N-methylmethanimine |
|---|---|
| PubChem CID | 145481005 |
| Molecular Formula | C20H17Cl2N3OS2 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 1-[8-[(3,5-dichloro-4-pyridinyl)methoxy]-2-methylquinolin-4-yl]sulfanyl-1-ethenylsulfanyl-N-methylmethanimine |
| SMILES | C=CS/C(=N\C)Sc1cc(C)nc2c(OCc3c(Cl)cncc3Cl)cccc12 |
| InChI | InChI=1S/C20H17Cl2N3OS2/c1-4-27-20(23-3)28-18-8-12(2)25-19-13(18)6-5-7-17(19)26-11-14-15(21)9-24-10-16(14)22/h4-10H,1,11H2,2-3H3/b23-20+ |
| InChIKey | MKAVHGRKYFRLLC-BSYVCWPDSA-N |
| XLogP | 6.78 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|