C13H21F3O3 — CID 145481342
2-[(E,2Z)-2-ethylidene-4-(trifluoromethoxy)hex-3-enyl]butane-1,3-diol (PubChem CID 145481342) has the molecular formula C13H21F3O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[(E,2Z)-2-ethylidene-4-(trifluoromethoxy)hex-3-enyl]butane-1,3-diol.
| Compound Name | 2-[(E,2Z)-2-ethylidene-4-(trifluoromethoxy)hex-3-enyl]butane-1,3-diol |
|---|---|
| PubChem CID | 145481342 |
| Molecular Formula | C13H21F3O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-[(E,2Z)-2-ethylidene-4-(trifluoromethoxy)hex-3-enyl]butane-1,3-diol |
| SMILES | C/C=C(\C=C(/CC)OC(F)(F)F)CC(CO)C(C)O |
| InChI | InChI=1S/C13H21F3O3/c1-4-10(6-11(8-17)9(3)18)7-12(5-2)19-13(14,15)16/h4,7,9,11,17-18H,5-6,8H2,1-3H3/b10-4-,12-7+ |
| InChIKey | GROLVHJPNXJAHU-DHUADYRJSA-N |
| XLogP | 3.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|