C27H40O4 — CID 145481477
2-[(E,6R)-2,6-dimethyloct-2-enyl]-3-hydroxy-4-methyl-2H-furan-5-one;3-[(4E)-4-methylhepta-4,6-dienyl]furan (PubChem CID 145481477) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is 2-[(E,6R)-2,6-dimethyloct-2-enyl]-3-hydroxy-4-methyl-2H-furan-5-one;3-[(4E)-4-methylhepta-4,6-dienyl]furan.
| Compound Name | 2-[(E,6R)-2,6-dimethyloct-2-enyl]-3-hydroxy-4-methyl-2H-furan-5-one;3-[(4E)-4-methylhepta-4,6-dienyl]furan |
|---|---|
| PubChem CID | 145481477 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 2-[(E,6R)-2,6-dimethyloct-2-enyl]-3-hydroxy-4-methyl-2H-furan-5-one;3-[(4E)-4-methylhepta-4,6-dienyl]furan |
| SMILES | C=C/C=C(\C)CCCc1ccoc1.CC[C@@H](C)CC/C=C(\C)CC1OC(=O)C(C)=C1O |
| InChI | InChI=1S/C15H24O3.C12H16O/c1-5-10(2)7-6-8-11(3)9-13-14(16)12(4)15(17)18-13;1-3-5-11(2)6-4-7-12-8-9-13-10-12/h8,10,13,16H,5-7,9H2,1-4H3;3,5,8-10H,1,4,6-7H2,2H3/b11-8+;11-5+/t10-,13?;/m1./s1 |
| InChIKey | BFVYOKGKPLVJQE-OUBDIDEASA-N |
| XLogP | 7.64 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|