C23H34N2O2 — CID 145481633
2-butoxyethyl 5-methyl-N-(3-phenylprop-1-en-2-yl)-2,3,6,7-tetrahydro-1H-azepine-4-carboximidate (PubChem CID 145481633) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 2-butoxyethyl 5-methyl-N-(3-phenylprop-1-en-2-yl)-2,3,6,7-tetrahydro-1H-azepine-4-carboximidate.
| Compound Name | 2-butoxyethyl 5-methyl-N-(3-phenylprop-1-en-2-yl)-2,3,6,7-tetrahydro-1H-azepine-4-carboximidate |
|---|---|
| PubChem CID | 145481633 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 2-butoxyethyl 5-methyl-N-(3-phenylprop-1-en-2-yl)-2,3,6,7-tetrahydro-1H-azepine-4-carboximidate |
| SMILES | C=C(Cc1ccccc1)/N=C(\OCCOCCCC)C1=C(C)CCNCC1 |
| InChI | InChI=1S/C23H34N2O2/c1-4-5-15-26-16-17-27-23(22-12-14-24-13-11-19(22)2)25-20(3)18-21-9-7-6-8-10-21/h6-10,24H,3-5,11-18H2,1-2H3/b25-23- |
| InChIKey | WGIJPGMZSXFSOE-BZZOAKBMSA-N |
| XLogP | 4.67 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|