C24H30FN3 — CID 145481658
2-[(4-fluorophenyl)methyl]-4-methyl-7-[(3Z,6Z)-octa-3,6-dienyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine (PubChem CID 145481658) has the molecular formula C24H30FN3 and a molecular weight of 379.52 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-4-methyl-7-[(3Z,6Z)-octa-3,6-dienyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine.
| Compound Name | 2-[(4-fluorophenyl)methyl]-4-methyl-7-[(3Z,6Z)-octa-3,6-dienyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine |
|---|---|
| PubChem CID | 145481658 |
| Molecular Formula | C24H30FN3 |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-4-methyl-7-[(3Z,6Z)-octa-3,6-dienyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine |
| SMILES | C/C=C\C/C=C\CCN1CCc2nc(Cc3ccc(F)cc3)nc(C)c2CC1 |
| InChI | InChI=1S/C24H30FN3/c1-3-4-5-6-7-8-15-28-16-13-22-19(2)26-24(27-23(22)14-17-28)18-20-9-11-21(25)12-10-20/h3-4,6-7,9-12H,5,8,13-18H2,1-2H3/b4-3-,7-6- |
| InChIKey | AMFCONFVEQSZKZ-CWWKMNTPSA-N |
| XLogP | 4.83 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|