About 6-methyl-7-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine
6-methyl-7-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine (PubChem CID 14548171) has the molecular formula C11H17NS
and a molecular weight of 195.33 g/mol. Its IUPAC name is 6-methyl-7-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine.
Molecular Properties
| Compound Name | 6-methyl-7-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine |
| PubChem CID | 14548171 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 6-methyl-7-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine |
| SMILES | CC(C)C1c2sccc2CCN1C |
| InChI | InChI=1S/C11H17NS/c1-8(2)10-11-9(5-7-13-11)4-6-12(10)3/h5,7-8,10H,4,6H2,1-3H3 |
| InChIKey | QKQIZBXKGOBGFZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-7-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-7-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine?
The IUPAC name of 6-methyl-7-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine (CID 14548171) is 6-methyl-7-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine.
What is the SMILES notation for 6-methyl-7-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine?
The canonical SMILES for 6-methyl-7-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine is CC(C)C1c2sccc2CCN1C.
What is the InChIKey of 6-methyl-7-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine?
The InChIKey is QKQIZBXKGOBGFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NS/c1-8(2)10-11-9(5-7-13-11)4-6-12(10)3/h5,7-8,10H,4,6H2,1-3H3.
What are the key properties of 6-methyl-7-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine?
6-methyl-7-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine has a molecular weight of 195.33 g/mol, XLogP of 2.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-7-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine is sourced from PubChem (CID 14548171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).