C17H18F3N7O2 — CID 145481755
N-(1-aminoethylidene)-4-(3-hydroxypropylamino)-7-(trifluoromethoxy)imidazo[1,2-a]quinoxaline-1-carboximidamide (PubChem CID 145481755) has the molecular formula C17H18F3N7O2 and a molecular weight of 409.37 g/mol. Its IUPAC name is N-(1-aminoethylidene)-4-(3-hydroxypropylamino)-7-(trifluoromethoxy)imidazo[1,2-a]quinoxaline-1-carboximidamide.
| Compound Name | N-(1-aminoethylidene)-4-(3-hydroxypropylamino)-7-(trifluoromethoxy)imidazo[1,2-a]quinoxaline-1-carboximidamide |
|---|---|
| PubChem CID | 145481755 |
| Molecular Formula | C17H18F3N7O2 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-(1-aminoethylidene)-4-(3-hydroxypropylamino)-7-(trifluoromethoxy)imidazo[1,2-a]quinoxaline-1-carboximidamide |
| SMILES | [H]/N=C(\N=C(/C)N)c1cnc2c(NCCCO)nc3cc(OC(F)(F)F)ccc3n12 |
| InChI | InChI=1S/C17H18F3N7O2/c1-9(21)25-14(22)13-8-24-16-15(23-5-2-6-28)26-11-7-10(29-17(18,19)20)3-4-12(11)27(13)16/h3-4,7-8,28H,2,5-6H2,1H3,(H,23,26)(H3,21,22,25) |
| InChIKey | ZZXVHYANWNIQCU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|