C24H34F3NO — CID 145481803
(4E,6Z)-N-[(3Z,5Z)-3-[(Z)-but-1-enyl]-4-ethylhepta-3,5-dien-2-yl]-4-methyl-8-(trifluoromethyl)nona-4,6,8-trienamide (PubChem CID 145481803) has the molecular formula C24H34F3NO and a molecular weight of 409.54 g/mol. Its IUPAC name is (4E,6Z)-N-[(3Z,5Z)-3-[(Z)-but-1-enyl]-4-ethylhepta-3,5-dien-2-yl]-4-methyl-8-(trifluoromethyl)nona-4,6,8-trienamide.
| Compound Name | (4E,6Z)-N-[(3Z,5Z)-3-[(Z)-but-1-enyl]-4-ethylhepta-3,5-dien-2-yl]-4-methyl-8-(trifluoromethyl)nona-4,6,8-trienamide |
|---|---|
| PubChem CID | 145481803 |
| Molecular Formula | C24H34F3NO |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | (4E,6Z)-N-[(3Z,5Z)-3-[(Z)-but-1-enyl]-4-ethylhepta-3,5-dien-2-yl]-4-methyl-8-(trifluoromethyl)nona-4,6,8-trienamide |
| SMILES | C=C(/C=C\C=C(/C)CCC(=O)NC(C)C(/C=C\CC)=C(\C=C/C)CC)C(F)(F)F |
| InChI | InChI=1S/C24H34F3NO/c1-7-10-15-22(21(9-3)12-8-2)20(6)28-23(29)17-16-18(4)13-11-14-19(5)24(25,26)27/h8,10-15,20H,5,7,9,16-17H2,1-4,6H3,(H,28,29)/b12-8-,14-11-,15-10-,18-13+,22-21- |
| InChIKey | NXTOKAWXESMOJI-QMPLNDHUSA-N |
| XLogP | 7.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|