About ethane;ethene;4-ethyl-2,4-dihydrocyclopenta[a]indene
ethane;ethene;4-ethyl-2,4-dihydrocyclopenta[a]indene (PubChem CID 145481812) has the molecular formula C18H24
and a molecular weight of 240.39 g/mol. Its IUPAC name is ethane;ethene;4-ethyl-2,4-dihydrocyclopenta[a]indene.
Molecular Properties
| Compound Name | ethane;ethene;4-ethyl-2,4-dihydrocyclopenta[a]indene |
| PubChem CID | 145481812 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | ethane;ethene;4-ethyl-2,4-dihydrocyclopenta[a]indene |
| SMILES | C=C.CC.CCC1C2=CCC=C2c2ccccc21 |
| InChI | InChI=1S/C14H14.C2H6.C2H4/c1-2-10-11-6-3-4-7-13(11)14-9-5-8-12(10)14;2*1-2/h3-4,6-10H,2,5H2,1H3;1-2H3;1-2H2 |
| InChIKey | XYUVDKABHJRSDI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;4-ethyl-2,4-dihydrocyclopenta[a]indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;4-ethyl-2,4-dihydrocyclopenta[a]indene?
The IUPAC name of ethane;ethene;4-ethyl-2,4-dihydrocyclopenta[a]indene (CID 145481812) is ethane;ethene;4-ethyl-2,4-dihydrocyclopenta[a]indene.
What is the SMILES notation for ethane;ethene;4-ethyl-2,4-dihydrocyclopenta[a]indene?
The canonical SMILES for ethane;ethene;4-ethyl-2,4-dihydrocyclopenta[a]indene is C=C.CC.CCC1C2=CCC=C2c2ccccc21.
What is the InChIKey of ethane;ethene;4-ethyl-2,4-dihydrocyclopenta[a]indene?
The InChIKey is XYUVDKABHJRSDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C2H6.C2H4/c1-2-10-11-6-3-4-7-13(11)14-9-5-8-12(10)14;2*1-2/h3-4,6-10H,2,5H2,1H3;1-2H3;1-2H2.
What are the key properties of ethane;ethene;4-ethyl-2,4-dihydrocyclopenta[a]indene?
ethane;ethene;4-ethyl-2,4-dihydrocyclopenta[a]indene has a molecular weight of 240.39 g/mol, XLogP of 5.74, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;4-ethyl-2,4-dihydrocyclopenta[a]indene is sourced from PubChem (CID 145481812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).