About ethane;methyl piperidine-1-carboxylate;prop-1-ene
ethane;methyl piperidine-1-carboxylate;prop-1-ene (PubChem CID 145482087) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is ethane;methyl piperidine-1-carboxylate;prop-1-ene.
Molecular Properties
| Compound Name | ethane;methyl piperidine-1-carboxylate;prop-1-ene |
| PubChem CID | 145482087 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | ethane;methyl piperidine-1-carboxylate;prop-1-ene |
| SMILES | C=CC.CC.COC(=O)N1CCCCC1 |
| InChI | InChI=1S/C7H13NO2.C3H6.C2H6/c1-10-7(9)8-5-3-2-4-6-8;1-3-2;1-2/h2-6H2,1H3;3H,1H2,2H3;1-2H3 |
| InChIKey | AHLOUIOXSUSDAQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl piperidine-1-carboxylate;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl piperidine-1-carboxylate;prop-1-ene?
The IUPAC name of ethane;methyl piperidine-1-carboxylate;prop-1-ene (CID 145482087) is ethane;methyl piperidine-1-carboxylate;prop-1-ene.
What is the SMILES notation for ethane;methyl piperidine-1-carboxylate;prop-1-ene?
The canonical SMILES for ethane;methyl piperidine-1-carboxylate;prop-1-ene is C=CC.CC.COC(=O)N1CCCCC1.
What is the InChIKey of ethane;methyl piperidine-1-carboxylate;prop-1-ene?
The InChIKey is AHLOUIOXSUSDAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C3H6.C2H6/c1-10-7(9)8-5-3-2-4-6-8;1-3-2;1-2/h2-6H2,1H3;3H,1H2,2H3;1-2H3.
What are the key properties of ethane;methyl piperidine-1-carboxylate;prop-1-ene?
ethane;methyl piperidine-1-carboxylate;prop-1-ene has a molecular weight of 215.34 g/mol, XLogP of 3.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl piperidine-1-carboxylate;prop-1-ene is sourced from PubChem (CID 145482087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).