About 2-[[3-(2-chlorophenyl)-8-methylquinoxalin-2-yl]methyl]isoindole-1,3-dione;ethane
2-[[3-(2-chlorophenyl)-8-methylquinoxalin-2-yl]methyl]isoindole-1,3-dione;ethane (PubChem CID 145483294) has the molecular formula C26H22ClN3O2
and a molecular weight of 443.93 g/mol. Its IUPAC name is 2-[[3-(2-chlorophenyl)-8-methylquinoxalin-2-yl]methyl]isoindole-1,3-dione;ethane.
Molecular Properties
| Compound Name | 2-[[3-(2-chlorophenyl)-8-methylquinoxalin-2-yl]methyl]isoindole-1,3-dione;ethane |
| PubChem CID | 145483294 |
| Molecular Formula | C26H22ClN3O2 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-[[3-(2-chlorophenyl)-8-methylquinoxalin-2-yl]methyl]isoindole-1,3-dione;ethane |
| SMILES | CC.Cc1cccc2nc(-c3ccccc3Cl)c(CN3C(=O)c4ccccc4C3=O)nc12 |
| InChI | InChI=1S/C24H16ClN3O2.C2H6/c1-14-7-6-12-19-21(14)27-20(22(26-19)17-10-4-5-11-18(17)25)13-28-23(29)15-8-2-3-9-16(15)24(28)30;1-2/h2-12H,13H2,1H3;1-2H3 |
| InChIKey | XRZKWBNIQDTSTA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-(2-chlorophenyl)-8-methylquinoxalin-2-yl]methyl]isoindole-1,3-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(2-chlorophenyl)-8-methylquinoxalin-2-yl]methyl]isoindole-1,3-dione;ethane?
The IUPAC name of 2-[[3-(2-chlorophenyl)-8-methylquinoxalin-2-yl]methyl]isoindole-1,3-dione;ethane (CID 145483294) is 2-[[3-(2-chlorophenyl)-8-methylquinoxalin-2-yl]methyl]isoindole-1,3-dione;ethane.
What is the SMILES notation for 2-[[3-(2-chlorophenyl)-8-methylquinoxalin-2-yl]methyl]isoindole-1,3-dione;ethane?
The canonical SMILES for 2-[[3-(2-chlorophenyl)-8-methylquinoxalin-2-yl]methyl]isoindole-1,3-dione;ethane is CC.Cc1cccc2nc(-c3ccccc3Cl)c(CN3C(=O)c4ccccc4C3=O)nc12.
What is the InChIKey of 2-[[3-(2-chlorophenyl)-8-methylquinoxalin-2-yl]methyl]isoindole-1,3-dione;ethane?
The InChIKey is XRZKWBNIQDTSTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16ClN3O2.C2H6/c1-14-7-6-12-19-21(14)27-20(22(26-19)17-10-4-5-11-18(17)25)13-28-23(29)15-8-2-3-9-16(15)24(28)30;1-2/h2-12H,13H2,1H3;1-2H3.
What are the key properties of 2-[[3-(2-chlorophenyl)-8-methylquinoxalin-2-yl]methyl]isoindole-1,3-dione;ethane?
2-[[3-(2-chlorophenyl)-8-methylquinoxalin-2-yl]methyl]isoindole-1,3-dione;ethane has a molecular weight of 443.93 g/mol, XLogP of 6.08, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(2-chlorophenyl)-8-methylquinoxalin-2-yl]methyl]isoindole-1,3-dione;ethane is sourced from PubChem (CID 145483294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).