About 2,8-dichloro-3-ethylquinoline;isoindole-1,3-dione
2,8-dichloro-3-ethylquinoline;isoindole-1,3-dione (PubChem CID 145483325) has the molecular formula C19H14Cl2N2O2
and a molecular weight of 373.24 g/mol. Its IUPAC name is 2,8-dichloro-3-ethylquinoline;isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2,8-dichloro-3-ethylquinoline;isoindole-1,3-dione |
| PubChem CID | 145483325 |
| Molecular Formula | C19H14Cl2N2O2 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 2,8-dichloro-3-ethylquinoline;isoindole-1,3-dione |
| SMILES | CCc1cc2cccc(Cl)c2nc1Cl.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C11H9Cl2N.C8H5NO2/c1-2-7-6-8-4-3-5-9(12)10(8)14-11(7)13;10-7-5-3-1-2-4-6(5)8(11)9-7/h3-6H,2H2,1H3;1-4H,(H,9,10,11) |
| InChIKey | YACBAFXXHUCDDD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2,8-dichloro-3-ethylquinoline;isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dichloro-3-ethylquinoline;isoindole-1,3-dione?
The IUPAC name of 2,8-dichloro-3-ethylquinoline;isoindole-1,3-dione (CID 145483325) is 2,8-dichloro-3-ethylquinoline;isoindole-1,3-dione.
What is the SMILES notation for 2,8-dichloro-3-ethylquinoline;isoindole-1,3-dione?
The canonical SMILES for 2,8-dichloro-3-ethylquinoline;isoindole-1,3-dione is CCc1cc2cccc(Cl)c2nc1Cl.O=C1NC(=O)c2ccccc21.
What is the InChIKey of 2,8-dichloro-3-ethylquinoline;isoindole-1,3-dione?
The InChIKey is YACBAFXXHUCDDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2N.C8H5NO2/c1-2-7-6-8-4-3-5-9(12)10(8)14-11(7)13;10-7-5-3-1-2-4-6(5)8(11)9-7/h3-6H,2H2,1H3;1-4H,(H,9,10,11).
What are the key properties of 2,8-dichloro-3-ethylquinoline;isoindole-1,3-dione?
2,8-dichloro-3-ethylquinoline;isoindole-1,3-dione has a molecular weight of 373.24 g/mol, XLogP of 4.67, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dichloro-3-ethylquinoline;isoindole-1,3-dione is sourced from PubChem (CID 145483325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).