About N'-acetyl-8-chloro-3-ethylquinoline-2-carbohydrazide;isoindole-1,3-dione
N'-acetyl-8-chloro-3-ethylquinoline-2-carbohydrazide;isoindole-1,3-dione (PubChem CID 145483347) has the molecular formula C22H19ClN4O4
and a molecular weight of 438.87 g/mol. Its IUPAC name is N'-acetyl-8-chloro-3-ethylquinoline-2-carbohydrazide;isoindole-1,3-dione.
Molecular Properties
| Compound Name | N'-acetyl-8-chloro-3-ethylquinoline-2-carbohydrazide;isoindole-1,3-dione |
| PubChem CID | 145483347 |
| Molecular Formula | C22H19ClN4O4 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | N'-acetyl-8-chloro-3-ethylquinoline-2-carbohydrazide;isoindole-1,3-dione |
| SMILES | CCc1cc2cccc(Cl)c2nc1C(=O)NNC(C)=O.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C14H14ClN3O2.C8H5NO2/c1-3-9-7-10-5-4-6-11(15)12(10)16-13(9)14(20)18-17-8(2)19;10-7-5-3-1-2-4-6(5)8(11)9-7/h4-7H,3H2,1-2H3,(H,17,19)(H,18,20);1-4H,(H,9,10,11) |
| InChIKey | NIFOMXISVYMWKM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N'-acetyl-8-chloro-3-ethylquinoline-2-carbohydrazide;isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-acetyl-8-chloro-3-ethylquinoline-2-carbohydrazide;isoindole-1,3-dione?
The IUPAC name of N'-acetyl-8-chloro-3-ethylquinoline-2-carbohydrazide;isoindole-1,3-dione (CID 145483347) is N'-acetyl-8-chloro-3-ethylquinoline-2-carbohydrazide;isoindole-1,3-dione.
What is the SMILES notation for N'-acetyl-8-chloro-3-ethylquinoline-2-carbohydrazide;isoindole-1,3-dione?
The canonical SMILES for N'-acetyl-8-chloro-3-ethylquinoline-2-carbohydrazide;isoindole-1,3-dione is CCc1cc2cccc(Cl)c2nc1C(=O)NNC(C)=O.O=C1NC(=O)c2ccccc21.
What is the InChIKey of N'-acetyl-8-chloro-3-ethylquinoline-2-carbohydrazide;isoindole-1,3-dione?
The InChIKey is NIFOMXISVYMWKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClN3O2.C8H5NO2/c1-3-9-7-10-5-4-6-11(15)12(10)16-13(9)14(20)18-17-8(2)19;10-7-5-3-1-2-4-6(5)8(11)9-7/h4-7H,3H2,1-2H3,(H,17,19)(H,18,20);1-4H,(H,9,10,11).
What are the key properties of N'-acetyl-8-chloro-3-ethylquinoline-2-carbohydrazide;isoindole-1,3-dione?
N'-acetyl-8-chloro-3-ethylquinoline-2-carbohydrazide;isoindole-1,3-dione has a molecular weight of 438.87 g/mol, XLogP of 2.80, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-acetyl-8-chloro-3-ethylquinoline-2-carbohydrazide;isoindole-1,3-dione is sourced from PubChem (CID 145483347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).