C24H17F3N4O2 — CID 145483369
2-[(1S)-1-[8-methyl-2-[3-(trifluoromethyl)pyrazol-1-yl]quinolin-3-yl]ethyl]isoindole-1,3-dione (PubChem CID 145483369) has the molecular formula C24H17F3N4O2 and a molecular weight of 450.42 g/mol. Its IUPAC name is 2-[(1S)-1-[8-methyl-2-[3-(trifluoromethyl)pyrazol-1-yl]quinolin-3-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S)-1-[8-methyl-2-[3-(trifluoromethyl)pyrazol-1-yl]quinolin-3-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 145483369 |
| Molecular Formula | C24H17F3N4O2 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-[(1S)-1-[8-methyl-2-[3-(trifluoromethyl)pyrazol-1-yl]quinolin-3-yl]ethyl]isoindole-1,3-dione |
| SMILES | Cc1cccc2cc([C@H](C)N3C(=O)c4ccccc4C3=O)c(-n3ccc(C(F)(F)F)n3)nc12 |
| InChI | InChI=1S/C24H17F3N4O2/c1-13-6-5-7-15-12-18(14(2)31-22(32)16-8-3-4-9-17(16)23(31)33)21(28-20(13)15)30-11-10-19(29-30)24(25,26)27/h3-12,14H,1-2H3/t14-/m0/s1 |
| InChIKey | BHWYEFLRNGCGCD-AWEZNQCLSA-N |
| XLogP | 5.10 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|