About difluoromethane;1-[3-(fluoromethoxy)phenyl]-N-methylmethanamine;molecular hydrogen
difluoromethane;1-[3-(fluoromethoxy)phenyl]-N-methylmethanamine;molecular hydrogen (PubChem CID 145483741) has the molecular formula C10H16F3NO
and a molecular weight of 223.24 g/mol. Its IUPAC name is difluoromethane;1-[3-(fluoromethoxy)phenyl]-N-methylmethanamine;molecular hydrogen.
Molecular Properties
| Compound Name | difluoromethane;1-[3-(fluoromethoxy)phenyl]-N-methylmethanamine;molecular hydrogen |
| PubChem CID | 145483741 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | difluoromethane;1-[3-(fluoromethoxy)phenyl]-N-methylmethanamine;molecular hydrogen |
| SMILES | CNCc1cccc(OCF)c1.FCF.[H][H] |
| InChI | InChI=1S/C9H12FNO.CH2F2.H2/c1-11-6-8-3-2-4-9(5-8)12-7-10;2-1-3;/h2-5,11H,6-7H2,1H3;1H2;1H |
| InChIKey | SHWWNFUYUQZQMU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze difluoromethane;1-[3-(fluoromethoxy)phenyl]-N-methylmethanamine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromethane;1-[3-(fluoromethoxy)phenyl]-N-methylmethanamine;molecular hydrogen?
The IUPAC name of difluoromethane;1-[3-(fluoromethoxy)phenyl]-N-methylmethanamine;molecular hydrogen (CID 145483741) is difluoromethane;1-[3-(fluoromethoxy)phenyl]-N-methylmethanamine;molecular hydrogen.
What is the SMILES notation for difluoromethane;1-[3-(fluoromethoxy)phenyl]-N-methylmethanamine;molecular hydrogen?
The canonical SMILES for difluoromethane;1-[3-(fluoromethoxy)phenyl]-N-methylmethanamine;molecular hydrogen is CNCc1cccc(OCF)c1.FCF.[H][H].
What is the InChIKey of difluoromethane;1-[3-(fluoromethoxy)phenyl]-N-methylmethanamine;molecular hydrogen?
The InChIKey is SHWWNFUYUQZQMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FNO.CH2F2.H2/c1-11-6-8-3-2-4-9(5-8)12-7-10;2-1-3;/h2-5,11H,6-7H2,1H3;1H2;1H.
What are the key properties of difluoromethane;1-[3-(fluoromethoxy)phenyl]-N-methylmethanamine;molecular hydrogen?
difluoromethane;1-[3-(fluoromethoxy)phenyl]-N-methylmethanamine;molecular hydrogen has a molecular weight of 223.24 g/mol, XLogP of 2.84, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromethane;1-[3-(fluoromethoxy)phenyl]-N-methylmethanamine;molecular hydrogen is sourced from PubChem (CID 145483741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).