C30H41NO4S — CID 145484617
(Z,6E,8S)-3-hydroxy-4,4,8,12-tetramethyl-15-(2-methyl-1,3-benzothiazol-5-yl)-5-oxo-6-prop-2-enylidenepentadec-12-enoic acid (PubChem CID 145484617) has the molecular formula C30H41NO4S and a molecular weight of 511.73 g/mol. Its IUPAC name is (Z,6E,8S)-3-hydroxy-4,4,8,12-tetramethyl-15-(2-methyl-1,3-benzothiazol-5-yl)-5-oxo-6-prop-2-enylidenepentadec-12-enoic acid.
| Compound Name | (Z,6E,8S)-3-hydroxy-4,4,8,12-tetramethyl-15-(2-methyl-1,3-benzothiazol-5-yl)-5-oxo-6-prop-2-enylidenepentadec-12-enoic acid |
|---|---|
| PubChem CID | 145484617 |
| Molecular Formula | C30H41NO4S |
| Molecular Weight | 511.73 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | (Z,6E,8S)-3-hydroxy-4,4,8,12-tetramethyl-15-(2-methyl-1,3-benzothiazol-5-yl)-5-oxo-6-prop-2-enylidenepentadec-12-enoic acid |
| SMILES | C=C/C=C(\C[C@@H](C)CCC/C(C)=C\CCc1ccc2sc(C)nc2c1)C(=O)C(C)(C)C(O)CC(=O)O |
| InChI | InChI=1S/C30H41NO4S/c1-7-10-24(29(35)30(5,6)27(32)19-28(33)34)17-21(3)13-8-11-20(2)12-9-14-23-15-16-26-25(18-23)31-22(4)36-26/h7,10,12,15-16,18,21,27,32H,1,8-9,11,13-14,17,19H2,2-6H3,(H,33,34)/b20-12-,24-10+/t21-,27?/m0/s1 |
| InChIKey | OUFWGOAYADHIDM-VLPASRRVSA-N |
| XLogP | 7.22 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.73 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|