C17H31NO — CID 145486556
(2E,4Z)-5,6-dimethylhepta-2,4,6-trien-3-amine;4-ethylhex-1-en-2-ol (PubChem CID 145486556) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is (2E,4Z)-5,6-dimethylhepta-2,4,6-trien-3-amine;4-ethylhex-1-en-2-ol.
| Compound Name | (2E,4Z)-5,6-dimethylhepta-2,4,6-trien-3-amine;4-ethylhex-1-en-2-ol |
|---|---|
| PubChem CID | 145486556 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | (2E,4Z)-5,6-dimethylhepta-2,4,6-trien-3-amine;4-ethylhex-1-en-2-ol |
| SMILES | C=C(C)/C(C)=C\C(N)=C/C.C=C(O)CC(CC)CC |
| InChI | InChI=1S/C9H15N.C8H16O/c1-5-9(10)6-8(4)7(2)3;1-4-8(5-2)6-7(3)9/h5-6H,2,10H2,1,3-4H3;8-9H,3-6H2,1-2H3/b8-6-,9-5+; |
| InChIKey | PNXFEQLQCCUJCW-MWGMOTBOSA-N |
| XLogP | 5.26 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|