About molybdenum;[4-[(4-phenoxynaphthalen-1-yl)methylamino]phenyl]methanone
molybdenum;[4-[(4-phenoxynaphthalen-1-yl)methylamino]phenyl]methanone (PubChem CID 145486743) has the molecular formula C24H18MoNO2-
and a molecular weight of 448.35 g/mol. Its IUPAC name is molybdenum;[4-[(4-phenoxynaphthalen-1-yl)methylamino]phenyl]methanone.
Molecular Properties
| Compound Name | molybdenum;[4-[(4-phenoxynaphthalen-1-yl)methylamino]phenyl]methanone |
| PubChem CID | 145486743 |
| Molecular Formula | C24H18MoNO2- |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | molybdenum;[4-[(4-phenoxynaphthalen-1-yl)methylamino]phenyl]methanone |
| SMILES | O=[C-]c1ccc(NCc2ccc(Oc3ccccc3)c3ccccc23)cc1.[Mo] |
| InChI | InChI=1S/C24H18NO2.Mo/c26-17-18-10-13-20(14-11-18)25-16-19-12-15-24(23-9-5-4-8-22(19)23)27-21-6-2-1-3-7-21;/h1-15,25H,16H2;/q-1; |
| InChIKey | IAKIKCDZZXLKRW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze molybdenum;[4-[(4-phenoxynaphthalen-1-yl)methylamino]phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molybdenum;[4-[(4-phenoxynaphthalen-1-yl)methylamino]phenyl]methanone?
The IUPAC name of molybdenum;[4-[(4-phenoxynaphthalen-1-yl)methylamino]phenyl]methanone (CID 145486743) is molybdenum;[4-[(4-phenoxynaphthalen-1-yl)methylamino]phenyl]methanone.
What is the SMILES notation for molybdenum;[4-[(4-phenoxynaphthalen-1-yl)methylamino]phenyl]methanone?
The canonical SMILES for molybdenum;[4-[(4-phenoxynaphthalen-1-yl)methylamino]phenyl]methanone is O=[C-]c1ccc(NCc2ccc(Oc3ccccc3)c3ccccc23)cc1.[Mo].
What is the InChIKey of molybdenum;[4-[(4-phenoxynaphthalen-1-yl)methylamino]phenyl]methanone?
The InChIKey is IAKIKCDZZXLKRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18NO2.Mo/c26-17-18-10-13-20(14-11-18)25-16-19-12-15-24(23-9-5-4-8-22(19)23)27-21-6-2-1-3-7-21;/h1-15,25H,16H2;/q-1;.
What are the key properties of molybdenum;[4-[(4-phenoxynaphthalen-1-yl)methylamino]phenyl]methanone?
molybdenum;[4-[(4-phenoxynaphthalen-1-yl)methylamino]phenyl]methanone has a molecular weight of 448.35 g/mol, XLogP of 5.70, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molybdenum;[4-[(4-phenoxynaphthalen-1-yl)methylamino]phenyl]methanone is sourced from PubChem (CID 145486743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).