C9H10F6O2 — CID 14548675
1,1,2,2,3,3-hexafluoro-1,3-bis(prop-2-enoxy)propane (PubChem CID 14548675) has the molecular formula C9H10F6O2 and a molecular weight of 264.17 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-1,3-bis(prop-2-enoxy)propane.
| Compound Name | 1,1,2,2,3,3-hexafluoro-1,3-bis(prop-2-enoxy)propane |
|---|---|
| PubChem CID | 14548675 |
| Molecular Formula | C9H10F6O2 |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-1,3-bis(prop-2-enoxy)propane |
| SMILES | C=CCOC(F)(F)C(F)(F)C(F)(F)OCC=C |
| InChI | InChI=1S/C9H10F6O2/c1-3-5-16-8(12,13)7(10,11)9(14,15)17-6-4-2/h3-4H,1-2,5-6H2 |
| InChIKey | XDGZPZGRHDOZMP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|