About 6-fluoro-5-methyl-3-methylidene-5,6-dihydro-1H-indol-2-one
6-fluoro-5-methyl-3-methylidene-5,6-dihydro-1H-indol-2-one (PubChem CID 145486992) has the molecular formula C10H10FNO
and a molecular weight of 179.19 g/mol. Its IUPAC name is 6-fluoro-5-methyl-3-methylidene-5,6-dihydro-1H-indol-2-one.
Molecular Properties
| Compound Name | 6-fluoro-5-methyl-3-methylidene-5,6-dihydro-1H-indol-2-one |
| PubChem CID | 145486992 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 6-fluoro-5-methyl-3-methylidene-5,6-dihydro-1H-indol-2-one |
| SMILES | C=C1C(=O)NC2=CC(F)C(C)C=C12 |
| InChI | InChI=1S/C10H10FNO/c1-5-3-7-6(2)10(13)12-9(7)4-8(5)11/h3-5,8H,2H2,1H3,(H,12,13) |
| InChIKey | SPNQROWGXUAAQY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-5-methyl-3-methylidene-5,6-dihydro-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-5-methyl-3-methylidene-5,6-dihydro-1H-indol-2-one?
The IUPAC name of 6-fluoro-5-methyl-3-methylidene-5,6-dihydro-1H-indol-2-one (CID 145486992) is 6-fluoro-5-methyl-3-methylidene-5,6-dihydro-1H-indol-2-one.
What is the SMILES notation for 6-fluoro-5-methyl-3-methylidene-5,6-dihydro-1H-indol-2-one?
The canonical SMILES for 6-fluoro-5-methyl-3-methylidene-5,6-dihydro-1H-indol-2-one is C=C1C(=O)NC2=CC(F)C(C)C=C12.
What is the InChIKey of 6-fluoro-5-methyl-3-methylidene-5,6-dihydro-1H-indol-2-one?
The InChIKey is SPNQROWGXUAAQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO/c1-5-3-7-6(2)10(13)12-9(7)4-8(5)11/h3-5,8H,2H2,1H3,(H,12,13).
What are the key properties of 6-fluoro-5-methyl-3-methylidene-5,6-dihydro-1H-indol-2-one?
6-fluoro-5-methyl-3-methylidene-5,6-dihydro-1H-indol-2-one has a molecular weight of 179.19 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-5-methyl-3-methylidene-5,6-dihydro-1H-indol-2-one is sourced from PubChem (CID 145486992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).