C27H28ClNO4S — CID 14548734
(6-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl) 1-amino-4-ethylsulfanyl-9,10-dioxoanthracene-2-carboxylate (PubChem CID 14548734) has the molecular formula C27H28ClNO4S and a molecular weight of 498.04 g/mol. Its IUPAC name is (6-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl) 1-amino-4-ethylsulfanyl-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | (6-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl) 1-amino-4-ethylsulfanyl-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 14548734 |
| Molecular Formula | C27H28ClNO4S |
| Molecular Weight | 498.04 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | (6-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl) 1-amino-4-ethylsulfanyl-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CCSc1cc(C(=O)OC2CCC3CC(Cl)CCC3C2)c(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H28ClNO4S/c1-2-34-21-13-20(27(32)33-17-10-8-14-11-16(28)9-7-15(14)12-17)24(29)23-22(21)25(30)18-5-3-4-6-19(18)26(23)31/h3-6,13-17H,2,7-12,29H2,1H3 |
| InChIKey | LWHFRCAFERPGJR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.04 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|