C24H27NO — CID 145487482
N-[(4E,6Z,8E)-4-ethylidene-3,8-diphenyldeca-1,6,8-trien-2-yl]hydroxylamine (PubChem CID 145487482) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[(4E,6Z,8E)-4-ethylidene-3,8-diphenyldeca-1,6,8-trien-2-yl]hydroxylamine.
| Compound Name | N-[(4E,6Z,8E)-4-ethylidene-3,8-diphenyldeca-1,6,8-trien-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 145487482 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[(4E,6Z,8E)-4-ethylidene-3,8-diphenyldeca-1,6,8-trien-2-yl]hydroxylamine |
| SMILES | C=C(NO)C(/C(=C/C)C/C=C\C(=C/C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27NO/c1-4-20(22-13-8-6-9-14-22)17-12-18-21(5-2)24(19(3)25-26)23-15-10-7-11-16-23/h4-17,24-26H,3,18H2,1-2H3/b17-12-,20-4+,21-5+ |
| InChIKey | CTRWRKKOAOZXHL-BSERYRPKSA-N |
| XLogP | 6.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|