C15H19F7O — CID 145487541
(9Z,11Z)-9-ethenyl-1,1,1,2,2,3,3-heptafluorotrideca-9,11-dien-4-ol (PubChem CID 145487541) has the molecular formula C15H19F7O and a molecular weight of 348.30 g/mol. Its IUPAC name is (9Z,11Z)-9-ethenyl-1,1,1,2,2,3,3-heptafluorotrideca-9,11-dien-4-ol.
| Compound Name | (9Z,11Z)-9-ethenyl-1,1,1,2,2,3,3-heptafluorotrideca-9,11-dien-4-ol |
|---|---|
| PubChem CID | 145487541 |
| Molecular Formula | C15H19F7O |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (9Z,11Z)-9-ethenyl-1,1,1,2,2,3,3-heptafluorotrideca-9,11-dien-4-ol |
| SMILES | C=C/C(=C\C=C/C)CCCCC(O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H19F7O/c1-3-5-8-11(4-2)9-6-7-10-12(23)13(16,17)14(18,19)15(20,21)22/h3-5,8,12,23H,2,6-7,9-10H2,1H3/b5-3-,11-8+ |
| InChIKey | PNMVNCBUBQISQI-NJHUYJSNSA-N |
| XLogP | 5.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|